rel-(1R,3S,4R)-3-(benzylcarbamamido)-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(propan-2-yl)cyclopentane-1-carboxamide
Chemical Structure Depiction of
rel-(1R,3S,4R)-3-(benzylcarbamamido)-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(propan-2-yl)cyclopentane-1-carboxamide
rel-(1R,3S,4R)-3-(benzylcarbamamido)-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(propan-2-yl)cyclopentane-1-carboxamide
Compound characteristics
| Compound ID: | SC74-0563 |
| Compound Name: | rel-(1R,3S,4R)-3-(benzylcarbamamido)-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-N-(propan-2-yl)cyclopentane-1-carboxamide |
| Molecular Weight: | 447.54 |
| Molecular Formula: | C25 H29 N5 O3 |
| Smiles: | CC(C)NC([C@H]1C[C@@H]([C@@H](C1)c1nc(c2ccccc2)no1)NC(NCc1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.7001 |
| logD: | 3.7001 |
| logSw: | -3.9266 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 90.732 |
| InChI Key: | CBIMYQFYZVNNQE-HBMCJLEFSA-N |