rel-(4R,5R)-N-[(2,5-difluorophenyl)methyl]-2-[(4-fluorophenyl)methyl]-10-oxo-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide
Chemical Structure Depiction of
rel-(4R,5R)-N-[(2,5-difluorophenyl)methyl]-2-[(4-fluorophenyl)methyl]-10-oxo-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide
rel-(4R,5R)-N-[(2,5-difluorophenyl)methyl]-2-[(4-fluorophenyl)methyl]-10-oxo-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide
Compound characteristics
| Compound ID: | SC77-0951 |
| Compound Name: | rel-(4R,5R)-N-[(2,5-difluorophenyl)methyl]-2-[(4-fluorophenyl)methyl]-10-oxo-6-oxa-2,9-diazaspiro[4.5]decane-4-carboxamide |
| Molecular Weight: | 433.43 |
| Molecular Formula: | C22 H22 F3 N3 O3 |
| Smiles: | C1CO[C@@]2(CN(Cc3ccc(cc3)F)C[C@@H]2C(NCc2cc(ccc2F)F)=O)C(N1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.2468 |
| logD: | 1.9067 |
| logSw: | -2.8816 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.531 |
| InChI Key: | ALAWZCSPSBYPIC-AVRDEDQJSA-N |