2-ethoxy-N-[(4-oxo-2-phenyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[d]pyrimidin-7-yl)methyl]benzamide
Chemical Structure Depiction of
2-ethoxy-N-[(4-oxo-2-phenyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[d]pyrimidin-7-yl)methyl]benzamide
2-ethoxy-N-[(4-oxo-2-phenyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[d]pyrimidin-7-yl)methyl]benzamide
Compound characteristics
| Compound ID: | SC87-0528 |
| Compound Name: | 2-ethoxy-N-[(4-oxo-2-phenyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[d]pyrimidin-7-yl)methyl]benzamide |
| Molecular Weight: | 417.51 |
| Molecular Formula: | C25 H27 N3 O3 |
| Smiles: | CCOc1ccccc1C(NCC1CCC2=C(CC1)N=C(c1ccccc1)NC2=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6964 |
| logD: | 3.3401 |
| logSw: | -4.051 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.816 |
| InChI Key: | YQWUMBVZLJIMGY-QGZVFWFLSA-N |