N-benzyl-6-(cyclopropylmethyl)-7-oxo-2-oxa-6,10-diazaspiro[4.6]undecane-10-carboxamide
Chemical Structure Depiction of
N-benzyl-6-(cyclopropylmethyl)-7-oxo-2-oxa-6,10-diazaspiro[4.6]undecane-10-carboxamide
N-benzyl-6-(cyclopropylmethyl)-7-oxo-2-oxa-6,10-diazaspiro[4.6]undecane-10-carboxamide
Compound characteristics
| Compound ID: | SC96-0296 |
| Compound Name: | N-benzyl-6-(cyclopropylmethyl)-7-oxo-2-oxa-6,10-diazaspiro[4.6]undecane-10-carboxamide |
| Molecular Weight: | 357.45 |
| Molecular Formula: | C20 H27 N3 O3 |
| Smiles: | C1CN(CC2(CCOC2)N(CC2CC2)C1=O)C(NCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7819 |
| logD: | 1.7819 |
| logSw: | -2.0353 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.515 |
| InChI Key: | LAAKZVFNBJRFBX-HXUWFJFHSA-N |