3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-methylphenyl)acetyl]piperazin-2-one
Chemical Structure Depiction of
3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-methylphenyl)acetyl]piperazin-2-one
3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-methylphenyl)acetyl]piperazin-2-one
Compound characteristics
| Compound ID: | SD12-0022 |
| Compound Name: | 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-[(2-methylphenyl)acetyl]piperazin-2-one |
| Molecular Weight: | 328.37 |
| Molecular Formula: | C17 H20 N4 O3 |
| Smiles: | Cc1ccccc1CC(N1CCNC(C1Cc1nc(C)no1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5105 |
| logD: | 1.5105 |
| logSw: | -1.8436 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.865 |
| InChI Key: | WDUUFEBIDZXJKH-AWEZNQCLSA-N |