2-(2-ethyl-3-oxo-2,5,6,8-tetrahydro-3H-[1,2,4]triazolo[3,4-c][1,4]oxazin-8-yl)-N-{3-[ethyl(phenyl)amino]propyl}acetamide
Chemical Structure Depiction of
2-(2-ethyl-3-oxo-2,5,6,8-tetrahydro-3H-[1,2,4]triazolo[3,4-c][1,4]oxazin-8-yl)-N-{3-[ethyl(phenyl)amino]propyl}acetamide
2-(2-ethyl-3-oxo-2,5,6,8-tetrahydro-3H-[1,2,4]triazolo[3,4-c][1,4]oxazin-8-yl)-N-{3-[ethyl(phenyl)amino]propyl}acetamide
Compound characteristics
| Compound ID: | SD18-0212 |
| Compound Name: | 2-(2-ethyl-3-oxo-2,5,6,8-tetrahydro-3H-[1,2,4]triazolo[3,4-c][1,4]oxazin-8-yl)-N-{3-[ethyl(phenyl)amino]propyl}acetamide |
| Molecular Weight: | 387.48 |
| Molecular Formula: | C20 H29 N5 O3 |
| Smiles: | CCN(CCCNC(CC1C2=NN(CC)C(N2CCO1)=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6345 |
| logD: | 1.6054 |
| logSw: | -2.0846 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.945 |
| InChI Key: | RJABCAUHNFLUIO-KRWDZBQOSA-N |