1-(pyrrolidin-1-yl)-3-[2-(thiophene-2-sulfonyl)-2-azaspiro[4.5]decan-4-yl]propan-1-one
Chemical Structure Depiction of
1-(pyrrolidin-1-yl)-3-[2-(thiophene-2-sulfonyl)-2-azaspiro[4.5]decan-4-yl]propan-1-one
1-(pyrrolidin-1-yl)-3-[2-(thiophene-2-sulfonyl)-2-azaspiro[4.5]decan-4-yl]propan-1-one
Compound characteristics
| Compound ID: | SD25-0382 |
| Compound Name: | 1-(pyrrolidin-1-yl)-3-[2-(thiophene-2-sulfonyl)-2-azaspiro[4.5]decan-4-yl]propan-1-one |
| Molecular Weight: | 410.6 |
| Molecular Formula: | C20 H30 N2 O3 S2 |
| Smiles: | C1CCC2(CC1)CN(CC2CCC(N1CCCC1)=O)S(c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1101 |
| logD: | 3.1101 |
| logSw: | -3.1005 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.608 |
| InChI Key: | WCOOAWUDUUKYAL-QGZVFWFLSA-N |