3-(5-chloro-1H-benzimidazol-2-yl)-1-[7-(2-methoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]propan-1-one
Chemical Structure Depiction of
3-(5-chloro-1H-benzimidazol-2-yl)-1-[7-(2-methoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]propan-1-one
3-(5-chloro-1H-benzimidazol-2-yl)-1-[7-(2-methoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]propan-1-one
Compound characteristics
| Compound ID: | SD60-0098 |
| Compound Name: | 3-(5-chloro-1H-benzimidazol-2-yl)-1-[7-(2-methoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]propan-1-one |
| Molecular Weight: | 377.87 |
| Molecular Formula: | C19 H24 Cl N3 O3 |
| Smiles: | COCCC1CC2(CN(C2)C(CCc2nc3cc(ccc3[nH]2)[Cl])=O)OC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7695 |
| logD: | 2.7019 |
| logSw: | -3.5305 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.647 |
| InChI Key: | DRDCNGKPVMFMDN-CYBMUJFWSA-N |