3-(3,5-dimethyl-1H-pyrazol-1-yl)-1-(7-{2-[(2-fluorophenyl)methoxy]ethyl}-5-oxa-2-azaspiro[3.4]octan-2-yl)propan-1-one
Chemical Structure Depiction of
3-(3,5-dimethyl-1H-pyrazol-1-yl)-1-(7-{2-[(2-fluorophenyl)methoxy]ethyl}-5-oxa-2-azaspiro[3.4]octan-2-yl)propan-1-one
3-(3,5-dimethyl-1H-pyrazol-1-yl)-1-(7-{2-[(2-fluorophenyl)methoxy]ethyl}-5-oxa-2-azaspiro[3.4]octan-2-yl)propan-1-one
Compound characteristics
| Compound ID: | SD60-0338 |
| Compound Name: | 3-(3,5-dimethyl-1H-pyrazol-1-yl)-1-(7-{2-[(2-fluorophenyl)methoxy]ethyl}-5-oxa-2-azaspiro[3.4]octan-2-yl)propan-1-one |
| Molecular Weight: | 415.51 |
| Molecular Formula: | C23 H30 F N3 O3 |
| Smiles: | Cc1cc(C)n(CCC(N2CC3(CC(CCOCc4ccccc4F)CO3)C2)=O)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3244 |
| logD: | 2.3242 |
| logSw: | -2.6037 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.09 |
| InChI Key: | YNUNLGVLEBQFBB-IBGZPJMESA-N |