N-ethyl-2-[(4-fluorophenyl)methyl]-1-oxooctahydropyrazino[1,2-a][1,4]diazepine-9(6H)-carboxamide
Chemical Structure Depiction of
N-ethyl-2-[(4-fluorophenyl)methyl]-1-oxooctahydropyrazino[1,2-a][1,4]diazepine-9(6H)-carboxamide
N-ethyl-2-[(4-fluorophenyl)methyl]-1-oxooctahydropyrazino[1,2-a][1,4]diazepine-9(6H)-carboxamide
Compound characteristics
| Compound ID: | SD68-0832 |
| Compound Name: | N-ethyl-2-[(4-fluorophenyl)methyl]-1-oxooctahydropyrazino[1,2-a][1,4]diazepine-9(6H)-carboxamide |
| Molecular Weight: | 348.42 |
| Molecular Formula: | C18 H25 F N4 O2 |
| Smiles: | CCNC(N1CCCN2CCN(Cc3ccc(cc3)F)C(C2C1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.9764 |
| logD: | 0.7969 |
| logSw: | -2.1609 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.776 |
| InChI Key: | CWTGPSOQWKHJLK-INIZCTEOSA-N |