3-{2-[1-(benzenesulfonyl)pyrrolidin-2-yl]ethyl}-4-benzyl-4H-1,2,4-triazole
Chemical Structure Depiction of
3-{2-[1-(benzenesulfonyl)pyrrolidin-2-yl]ethyl}-4-benzyl-4H-1,2,4-triazole
3-{2-[1-(benzenesulfonyl)pyrrolidin-2-yl]ethyl}-4-benzyl-4H-1,2,4-triazole
Compound characteristics
| Compound ID: | SD73-0502 |
| Compound Name: | 3-{2-[1-(benzenesulfonyl)pyrrolidin-2-yl]ethyl}-4-benzyl-4H-1,2,4-triazole |
| Molecular Weight: | 396.51 |
| Molecular Formula: | C21 H24 N4 O2 S |
| Smiles: | C1CC(CCc2nncn2Cc2ccccc2)N(C1)S(c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7502 |
| logD: | 2.7502 |
| logSw: | -3.0679 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.799 |
| InChI Key: | ZYZIYFFQLJMDJB-LJQANCHMSA-N |