6-(3,4-dimethoxybenzene-1-sulfonyl)-8-(4-methyl-4H-1,2,4-triazol-3-yl)-6-azaspiro[3.4]octane
Chemical Structure Depiction of
6-(3,4-dimethoxybenzene-1-sulfonyl)-8-(4-methyl-4H-1,2,4-triazol-3-yl)-6-azaspiro[3.4]octane
6-(3,4-dimethoxybenzene-1-sulfonyl)-8-(4-methyl-4H-1,2,4-triazol-3-yl)-6-azaspiro[3.4]octane
Compound characteristics
| Compound ID: | SD74-0034 |
| Compound Name: | 6-(3,4-dimethoxybenzene-1-sulfonyl)-8-(4-methyl-4H-1,2,4-triazol-3-yl)-6-azaspiro[3.4]octane |
| Molecular Weight: | 392.48 |
| Molecular Formula: | C18 H24 N4 O4 S |
| Smiles: | Cn1cnnc1C1CN(CC12CCC2)S(c1ccc(c(c1)OC)OC)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.9108 |
| logD: | 0.9108 |
| logSw: | -2.252 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.607 |
| InChI Key: | BDWYSFIEWKBDKC-AWEZNQCLSA-N |