N-{[4-(azepan-1-yl)phenyl]methyl}-N-methylprop-2-enamide
Chemical Structure Depiction of
N-{[4-(azepan-1-yl)phenyl]methyl}-N-methylprop-2-enamide
N-{[4-(azepan-1-yl)phenyl]methyl}-N-methylprop-2-enamide
Compound characteristics
| Compound ID: | T001-1705 |
| Compound Name: | N-{[4-(azepan-1-yl)phenyl]methyl}-N-methylprop-2-enamide |
| Molecular Weight: | 272.39 |
| Molecular Formula: | C17 H24 N2 O |
| Smiles: | CN(Cc1ccc(cc1)N1CCCCCC1)C(C=C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4268 |
| logD: | 3.1864 |
| logSw: | -3.4103 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 19.9165 |
| InChI Key: | GNGFXTWZWLTXRY-UHFFFAOYSA-N |