8-(methoxyacetyl)-4-(2-methoxyethyl)-1lambda~6~-thia-4,8-diazaspiro[4.5]decane-1,1,3-trione
Chemical Structure Depiction of
8-(methoxyacetyl)-4-(2-methoxyethyl)-1lambda~6~-thia-4,8-diazaspiro[4.5]decane-1,1,3-trione
8-(methoxyacetyl)-4-(2-methoxyethyl)-1lambda~6~-thia-4,8-diazaspiro[4.5]decane-1,1,3-trione
Compound characteristics
| Compound ID: | T140-1356 |
| Compound Name: | 8-(methoxyacetyl)-4-(2-methoxyethyl)-1lambda~6~-thia-4,8-diazaspiro[4.5]decane-1,1,3-trione |
| Molecular Weight: | 334.39 |
| Molecular Formula: | C13 H22 N2 O6 S |
| Smiles: | COCCN1C(CS(C12CCN(CC2)C(COC)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -1.7896 |
| logD: | -1.8079 |
| logSw: | -0.7301 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 78.439 |
| InChI Key: | YHBWEFYRKOUHOY-UHFFFAOYSA-N |