ethyl 5-{[2-(1-cyclopropyl-5-methyl-1H-imidazol-2-yl)ethyl]sulfamoyl}-3-methyl-1-benzofuran-2-carboxylate
Chemical Structure Depiction of
ethyl 5-{[2-(1-cyclopropyl-5-methyl-1H-imidazol-2-yl)ethyl]sulfamoyl}-3-methyl-1-benzofuran-2-carboxylate
ethyl 5-{[2-(1-cyclopropyl-5-methyl-1H-imidazol-2-yl)ethyl]sulfamoyl}-3-methyl-1-benzofuran-2-carboxylate
Compound characteristics
| Compound ID: | T151-0203 |
| Compound Name: | ethyl 5-{[2-(1-cyclopropyl-5-methyl-1H-imidazol-2-yl)ethyl]sulfamoyl}-3-methyl-1-benzofuran-2-carboxylate |
| Molecular Weight: | 431.51 |
| Molecular Formula: | C21 H25 N3 O5 S |
| Smiles: | CCOC(c1c(C)c2cc(ccc2o1)S(NCCc1ncc(C)n1C1CC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4837 |
| logD: | 3.1687 |
| logSw: | -3.606 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.186 |
| InChI Key: | UGYNTAHTKWUJLU-UHFFFAOYSA-N |