N-(2-{1-[(4-fluorophenyl)methyl]-5-methyl-1H-imidazol-2-yl}ethyl)pyridine-3-sulfonamide
Chemical Structure Depiction of
N-(2-{1-[(4-fluorophenyl)methyl]-5-methyl-1H-imidazol-2-yl}ethyl)pyridine-3-sulfonamide
N-(2-{1-[(4-fluorophenyl)methyl]-5-methyl-1H-imidazol-2-yl}ethyl)pyridine-3-sulfonamide
Compound characteristics
| Compound ID: | T161-1145 |
| Compound Name: | N-(2-{1-[(4-fluorophenyl)methyl]-5-methyl-1H-imidazol-2-yl}ethyl)pyridine-3-sulfonamide |
| Molecular Weight: | 374.44 |
| Molecular Formula: | C18 H19 F N4 O2 S |
| Smiles: | Cc1cnc(CCNS(c2cccnc2)(=O)=O)n1Cc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 2.2455 |
| logD: | 2.1995 |
| logSw: | -2.2864 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.517 |
| InChI Key: | ZLIGZLXVQCOGIO-UHFFFAOYSA-N |