2-(2-methoxyphenyl)-1-[2-(3-methoxyphenyl)-7,8-dihydro-4H-pyrazolo[1,5-a][1,4]diazepin-5(6H)-yl]ethan-1-one
Chemical Structure Depiction of
2-(2-methoxyphenyl)-1-[2-(3-methoxyphenyl)-7,8-dihydro-4H-pyrazolo[1,5-a][1,4]diazepin-5(6H)-yl]ethan-1-one
2-(2-methoxyphenyl)-1-[2-(3-methoxyphenyl)-7,8-dihydro-4H-pyrazolo[1,5-a][1,4]diazepin-5(6H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | T200-0126 |
| Compound Name: | 2-(2-methoxyphenyl)-1-[2-(3-methoxyphenyl)-7,8-dihydro-4H-pyrazolo[1,5-a][1,4]diazepin-5(6H)-yl]ethan-1-one |
| Molecular Weight: | 391.47 |
| Molecular Formula: | C23 H25 N3 O3 |
| Smiles: | COc1cccc(c1)c1cc2CN(CCCn2n1)C(Cc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6693 |
| logD: | 3.6693 |
| logSw: | -3.9087 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.064 |
| InChI Key: | XJWJFHOLJJZODS-UHFFFAOYSA-N |