N-[(furan-2-yl)methyl]-N'-{1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]piperidin-4-yl}urea
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-N'-{1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]piperidin-4-yl}urea
N-[(furan-2-yl)methyl]-N'-{1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]piperidin-4-yl}urea
Compound characteristics
| Compound ID: | T377-0016 |
| Compound Name: | N-[(furan-2-yl)methyl]-N'-{1-[4-methyl-5-(4-methylphenyl)-1,1-dioxo-1H-1lambda~6~,2-thiazol-3-yl]piperidin-4-yl}urea |
| Molecular Weight: | 442.54 |
| Molecular Formula: | C22 H26 N4 O4 S |
| Smiles: | CC1=C(c2ccc(C)cc2)S(N=C1N1CCC(CC1)NC(NCc1ccco1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0491 |
| logD: | 3.0491 |
| logSw: | -3.4857 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.359 |
| InChI Key: | VQIXUBGNVGRXOE-UHFFFAOYSA-N |