N-[(3-fluorophenyl)methyl]-2-(morpholine-4-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
					Chemical Structure Depiction of
N-[(3-fluorophenyl)methyl]-2-(morpholine-4-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
			N-[(3-fluorophenyl)methyl]-2-(morpholine-4-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
Compound characteristics
| Compound ID: | T408-0437 | 
| Compound Name: | N-[(3-fluorophenyl)methyl]-2-(morpholine-4-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide | 
| Molecular Weight: | 402.49 | 
| Molecular Formula: | C21 H23 F N2 O3 S | 
| Smiles: | C1Cc2c(CC1C(NCc1cccc(c1)F)=O)cc(C(N1CCOCC1)=O)s2 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.7065 | 
| logD: | 2.7065 | 
| logSw: | -3.0317 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 50.147 | 
| InChI Key: | JMAXPZIOEYWVOI-OAHLLOKOSA-N | 
 
				 
				