2-(azepane-1-carbonyl)-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
Chemical Structure Depiction of
2-(azepane-1-carbonyl)-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
2-(azepane-1-carbonyl)-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide
Compound characteristics
| Compound ID: | T408-1173 |
| Compound Name: | 2-(azepane-1-carbonyl)-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxamide |
| Molecular Weight: | 378.53 |
| Molecular Formula: | C20 H30 N2 O3 S |
| Smiles: | COCCCNC(C1CCc2c(C1)cc(C(N1CCCCCC1)=O)s2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1293 |
| logD: | 3.1293 |
| logSw: | -3.1737 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.026 |
| InChI Key: | FDRIRSABLMHIEL-HNNXBMFYSA-N |