N-(5-benzyl-4-oxo-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-N'-(2-fluorophenyl)urea
Chemical Structure Depiction of
N-(5-benzyl-4-oxo-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-N'-(2-fluorophenyl)urea
N-(5-benzyl-4-oxo-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-N'-(2-fluorophenyl)urea
Compound characteristics
| Compound ID: | T416-0133 |
| Compound Name: | N-(5-benzyl-4-oxo-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazol-2-yl)-N'-(2-fluorophenyl)urea |
| Molecular Weight: | 382.41 |
| Molecular Formula: | C19 H15 F N4 O2 S |
| Smiles: | [H]N(C(Nc1ccccc1F)=O)c1nc2C(N(Cc3ccccc3)Cc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7135 |
| logD: | 3.6781 |
| logSw: | -4.0323 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.398 |
| InChI Key: | BJOOAXUYVCHWPY-UHFFFAOYSA-N |