N-[(2-chlorophenyl)methyl]-3-{1-[6-(propylamino)pyrimidin-4-yl]piperidin-4-yl}propanamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-3-{1-[6-(propylamino)pyrimidin-4-yl]piperidin-4-yl}propanamide
N-[(2-chlorophenyl)methyl]-3-{1-[6-(propylamino)pyrimidin-4-yl]piperidin-4-yl}propanamide
Compound characteristics
| Compound ID: | T422-0790 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-3-{1-[6-(propylamino)pyrimidin-4-yl]piperidin-4-yl}propanamide |
| Molecular Weight: | 415.97 |
| Molecular Formula: | C22 H30 Cl N5 O |
| Smiles: | CCCNc1cc(ncn1)N1CCC(CCC(NCc2ccccc2[Cl])=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 5.1689 |
| logD: | 5.1617 |
| logSw: | -5.6366 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.079 |
| InChI Key: | LJZCGLSYDZSMNB-UHFFFAOYSA-N |