N-(4-methylphenyl)-N'-(2-methyl[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea
Chemical Structure Depiction of
N-(4-methylphenyl)-N'-(2-methyl[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea
N-(4-methylphenyl)-N'-(2-methyl[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea
Compound characteristics
| Compound ID: | T482-0946 |
| Compound Name: | N-(4-methylphenyl)-N'-(2-methyl[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| Molecular Weight: | 281.31 |
| Molecular Formula: | C15 H15 N5 O |
| Smiles: | Cc1ccc(cc1)NC(Nc1cccn2c1nc(C)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4122 |
| logD: | 2.4121 |
| logSw: | -2.9005 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.145 |
| InChI Key: | FWGYJVRODWIACU-UHFFFAOYSA-N |