4-[(4-methoxyphenyl)methyl]-N-(2-methylpropyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
Chemical Structure Depiction of
4-[(4-methoxyphenyl)methyl]-N-(2-methylpropyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
4-[(4-methoxyphenyl)methyl]-N-(2-methylpropyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
Compound characteristics
| Compound ID: | T500-1322 |
| Compound Name: | 4-[(4-methoxyphenyl)methyl]-N-(2-methylpropyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide |
| Molecular Weight: | 374.52 |
| Molecular Formula: | C22 H34 N2 O3 |
| Smiles: | CC(C)CNC(N1CCC2(CC1)CC(CCO2)Cc1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9781 |
| logD: | 3.9781 |
| logSw: | -4.0889 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.175 |
| InChI Key: | FILIJZLCQGNJSH-IBGZPJMESA-N |