[1-(1H-indole-5-carbonyl)piperidin-4-yl](1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone
Chemical Structure Depiction of
[1-(1H-indole-5-carbonyl)piperidin-4-yl](1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone
[1-(1H-indole-5-carbonyl)piperidin-4-yl](1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone
Compound characteristics
| Compound ID: | T500-1897 |
| Compound Name: | [1-(1H-indole-5-carbonyl)piperidin-4-yl](1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
| Molecular Weight: | 409.53 |
| Molecular Formula: | C24 H31 N3 O3 |
| Smiles: | C1CCOC2(C1)CCN(CC2)C(C1CCN(CC1)C(c1ccc2c(cc[nH]2)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0238 |
| logD: | 2.0238 |
| logSw: | -2.6472 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.918 |
| InChI Key: | RCJUAJQUQVKYKL-UHFFFAOYSA-N |