{3-[(4-ethyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-1-yl}(2-fluorophenyl)methanone
Chemical Structure Depiction of
{3-[(4-ethyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-1-yl}(2-fluorophenyl)methanone
{3-[(4-ethyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-1-yl}(2-fluorophenyl)methanone
Compound characteristics
| Compound ID: | T501-0282 |
| Compound Name: | {3-[(4-ethyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-1-yl}(2-fluorophenyl)methanone |
| Molecular Weight: | 316.38 |
| Molecular Formula: | C17 H21 F N4 O |
| Smiles: | CCn1cnnc1CC1CCCN(C1)C(c1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7638 |
| logD: | 1.7636 |
| logSw: | -2.4792 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.877 |
| InChI Key: | UKEPTDHEWJOTJT-CYBMUJFWSA-N |