(3-{[4-(cyclopropylmethyl)-4H-1,2,4-triazol-3-yl]methyl}piperidin-1-yl)(thiophen-3-yl)methanone
Chemical Structure Depiction of
(3-{[4-(cyclopropylmethyl)-4H-1,2,4-triazol-3-yl]methyl}piperidin-1-yl)(thiophen-3-yl)methanone
(3-{[4-(cyclopropylmethyl)-4H-1,2,4-triazol-3-yl]methyl}piperidin-1-yl)(thiophen-3-yl)methanone
Compound characteristics
| Compound ID: | T501-0595 |
| Compound Name: | (3-{[4-(cyclopropylmethyl)-4H-1,2,4-triazol-3-yl]methyl}piperidin-1-yl)(thiophen-3-yl)methanone |
| Molecular Weight: | 330.45 |
| Molecular Formula: | C17 H22 N4 O S |
| Smiles: | C1CC(Cc2nncn2CC2CC2)CN(C1)C(c1ccsc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0516 |
| logD: | 2.0516 |
| logSw: | -2.5199 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 43.423 |
| InChI Key: | JISCXOXNWBMQEW-CQSZACIVSA-N |