N-(cyclopropylmethyl)-4-fluoro-1-(phenoxyacetyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-(cyclopropylmethyl)-4-fluoro-1-(phenoxyacetyl)piperidine-4-carboxamide
N-(cyclopropylmethyl)-4-fluoro-1-(phenoxyacetyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | T502-0994 |
| Compound Name: | N-(cyclopropylmethyl)-4-fluoro-1-(phenoxyacetyl)piperidine-4-carboxamide |
| Molecular Weight: | 334.39 |
| Molecular Formula: | C18 H23 F N2 O3 |
| Smiles: | C1CC1CNC(C1(CCN(CC1)C(COc1ccccc1)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.584 |
| logD: | 1.584 |
| logSw: | -1.881 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.795 |
| InChI Key: | GISSZZQHQCEVBR-UHFFFAOYSA-N |