4-fluoro-N-(2-methoxyethyl)-1-[(3-methoxyphenyl)acetyl]piperidine-4-carboxamide
Chemical Structure Depiction of
4-fluoro-N-(2-methoxyethyl)-1-[(3-methoxyphenyl)acetyl]piperidine-4-carboxamide
4-fluoro-N-(2-methoxyethyl)-1-[(3-methoxyphenyl)acetyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | T502-1834 |
| Compound Name: | 4-fluoro-N-(2-methoxyethyl)-1-[(3-methoxyphenyl)acetyl]piperidine-4-carboxamide |
| Molecular Weight: | 352.4 |
| Molecular Formula: | C18 H25 F N2 O4 |
| Smiles: | COCCNC(C1(CCN(CC1)C(Cc1cccc(c1)OC)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3738 |
| logD: | 1.3738 |
| logSw: | -1.9637 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.772 |
| InChI Key: | JXANLTPPGRKVPZ-UHFFFAOYSA-N |