4-fluoro-N-(2-methoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
4-fluoro-N-(2-methoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-4-carboxamide
4-fluoro-N-(2-methoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | T502-1854 |
| Compound Name: | 4-fluoro-N-(2-methoxyethyl)-1-(pyrazine-2-carbonyl)piperidine-4-carboxamide |
| Molecular Weight: | 310.33 |
| Molecular Formula: | C14 H19 F N4 O3 |
| Smiles: | COCCNC(C1(CCN(CC1)C(c1cnccn1)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | -0.5656 |
| logD: | -0.5656 |
| logSw: | -1.3042 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.321 |
| InChI Key: | NRRQDBJYGQDDRO-UHFFFAOYSA-N |