(5-cyclopentyl-5H-thieno[2,3-c]pyrrol-2-yl)(thiomorpholin-4-yl)methanone
Chemical Structure Depiction of
(5-cyclopentyl-5H-thieno[2,3-c]pyrrol-2-yl)(thiomorpholin-4-yl)methanone
(5-cyclopentyl-5H-thieno[2,3-c]pyrrol-2-yl)(thiomorpholin-4-yl)methanone
Compound characteristics
| Compound ID: | T503-0534 |
| Compound Name: | (5-cyclopentyl-5H-thieno[2,3-c]pyrrol-2-yl)(thiomorpholin-4-yl)methanone |
| Molecular Weight: | 320.47 |
| Molecular Formula: | C16 H20 N2 O S2 |
| Smiles: | C1CCC(C1)n1cc2cc(C(N3CCSCC3)=O)sc2c1 |
| Stereo: | ACHIRAL |
| logP: | 3.1535 |
| logD: | 3.1535 |
| logSw: | -3.27 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 21.6045 |
| InChI Key: | YZHQVYAJWCMEAV-UHFFFAOYSA-N |