1-{2-[2-(4-phenyl-1H-1,2,3-triazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
Chemical Structure Depiction of
1-{2-[2-(4-phenyl-1H-1,2,3-triazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
1-{2-[2-(4-phenyl-1H-1,2,3-triazol-1-yl)ethyl]piperidin-1-yl}propan-1-one
Compound characteristics
| Compound ID: | T505-0108 |
| Compound Name: | 1-{2-[2-(4-phenyl-1H-1,2,3-triazol-1-yl)ethyl]piperidin-1-yl}propan-1-one |
| Molecular Weight: | 312.41 |
| Molecular Formula: | C18 H24 N4 O |
| Smiles: | CCC(N1CCCCC1CCn1cc(c2ccccc2)nn1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0245 |
| logD: | 3.0245 |
| logSw: | -2.8754 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.497 |
| InChI Key: | NBIUEJXFXCQEMS-MRXNPFEDSA-N |