(3,5-dimethylphenyl)(5-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-1-yl)methanone
Chemical Structure Depiction of
(3,5-dimethylphenyl)(5-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-1-yl)methanone
(3,5-dimethylphenyl)(5-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-1-yl)methanone
Compound characteristics
| Compound ID: | T599-3065 |
| Compound Name: | (3,5-dimethylphenyl)(5-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-1-yl)methanone |
| Molecular Weight: | 294.39 |
| Molecular Formula: | C19 H22 N2 O |
| Smiles: | Cc1cc(C)cc(c1)C(N1CCCN(C)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5675 |
| logD: | 3.5675 |
| logSw: | -3.7416 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 18.5111 |
| InChI Key: | QGGVSQRPXSHACH-UHFFFAOYSA-N |