3-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-5-(2-hydroxyethyl)-6-methylpyrimidin-4(3H)-one
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-5-(2-hydroxyethyl)-6-methylpyrimidin-4(3H)-one
3-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-5-(2-hydroxyethyl)-6-methylpyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | T604-0246 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-5-(2-hydroxyethyl)-6-methylpyrimidin-4(3H)-one |
| Molecular Weight: | 372.83 |
| Molecular Formula: | C20 H18 Cl F N2 O2 |
| Smiles: | CC1=C(CCO)C(N(Cc2ccc(cc2)[Cl])C(c2ccc(cc2)F)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.279 |
| logD: | 3.2789 |
| logSw: | -3.673 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.657 |
| InChI Key: | MNXUVFXQMNPUTI-UHFFFAOYSA-N |