(1H-indazol-3-yl){4-[4-(propan-2-yl)piperazin-1-yl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
Chemical Structure Depiction of
(1H-indazol-3-yl){4-[4-(propan-2-yl)piperazin-1-yl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
(1H-indazol-3-yl){4-[4-(propan-2-yl)piperazin-1-yl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone
Compound characteristics
| Compound ID: | T622-0045 |
| Compound Name: | (1H-indazol-3-yl){4-[4-(propan-2-yl)piperazin-1-yl]-1-oxa-9-azaspiro[5.5]undecan-9-yl}methanone |
| Molecular Weight: | 425.57 |
| Molecular Formula: | C24 H35 N5 O2 |
| Smiles: | CC(C)N1CCN(CC1)C1CCOC2(CCN(CC2)C(c2c3ccccc3[nH]n2)=O)C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2177 |
| logD: | 1.3111 |
| logSw: | -2.6794 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.693 |
| InChI Key: | CMLTYOKDBFTGQE-LJQANCHMSA-N |