1-[(5-bromofuran-2-yl)methyl]-3-(5-methyl-4H-1,2,4-triazol-3-yl)piperidine
Chemical Structure Depiction of
1-[(5-bromofuran-2-yl)methyl]-3-(5-methyl-4H-1,2,4-triazol-3-yl)piperidine
1-[(5-bromofuran-2-yl)methyl]-3-(5-methyl-4H-1,2,4-triazol-3-yl)piperidine
Compound characteristics
| Compound ID: | T629-0081 |
| Compound Name: | 1-[(5-bromofuran-2-yl)methyl]-3-(5-methyl-4H-1,2,4-triazol-3-yl)piperidine |
| Molecular Weight: | 325.21 |
| Molecular Formula: | C13 H17 Br N4 O |
| Smiles: | Cc1nnc(C2CCCN(C2)Cc2ccc(o2)[Br])[nH]1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.6286 |
| logD: | 1.0669 |
| logSw: | -2.083 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.398 |
| InChI Key: | WFWFOEXVDDDYPX-JTQLQIEISA-N |