{7-[(diethylamino)methyl]-2,3-dihydro-1,4-benzoxazepin-4(5H)-yl}(3-fluorophenyl)methanone
Chemical Structure Depiction of
{7-[(diethylamino)methyl]-2,3-dihydro-1,4-benzoxazepin-4(5H)-yl}(3-fluorophenyl)methanone
{7-[(diethylamino)methyl]-2,3-dihydro-1,4-benzoxazepin-4(5H)-yl}(3-fluorophenyl)methanone
Compound characteristics
| Compound ID: | T634-0342 |
| Compound Name: | {7-[(diethylamino)methyl]-2,3-dihydro-1,4-benzoxazepin-4(5H)-yl}(3-fluorophenyl)methanone |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C21 H25 F N2 O2 |
| Smiles: | CCN(CC)Cc1ccc2c(CN(CCO2)C(c2cccc(c2)F)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.2564 |
| logD: | 1.5028 |
| logSw: | -3.157 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.2636 |
| InChI Key: | QFFTVCFWLCVATF-UHFFFAOYSA-N |