N-[rel-(1R,5S)-8-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-methylpyrazine-2-carboxamide
Chemical Structure Depiction of
N-[rel-(1R,5S)-8-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-methylpyrazine-2-carboxamide
N-[rel-(1R,5S)-8-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-methylpyrazine-2-carboxamide
Compound characteristics
| Compound ID: | T651-0088 |
| Compound Name: | N-[rel-(1R,5S)-8-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-5-methylpyrazine-2-carboxamide |
| Molecular Weight: | 386.47 |
| Molecular Formula: | C19 H22 N4 O3 S |
| Smiles: | Cc1cnc(cn1)C(NC1C[C@@H]2CC[C@H](C1)N2S(c1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.0204 |
| logD: | 1.0204 |
| logSw: | -2.3145 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.403 |
| InChI Key: | AIZAPIZZIYEJOP-MQVJKMGUSA-N |