N-[rel-(1R,5S)-8-(3-cyclohexylpropanoyl)-8-azabicyclo[3.2.1]octan-3-yl]pyridine-4-carboxamide
Chemical Structure Depiction of
N-[rel-(1R,5S)-8-(3-cyclohexylpropanoyl)-8-azabicyclo[3.2.1]octan-3-yl]pyridine-4-carboxamide
N-[rel-(1R,5S)-8-(3-cyclohexylpropanoyl)-8-azabicyclo[3.2.1]octan-3-yl]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | T651-0292 |
| Compound Name: | N-[rel-(1R,5S)-8-(3-cyclohexylpropanoyl)-8-azabicyclo[3.2.1]octan-3-yl]pyridine-4-carboxamide |
| Molecular Weight: | 369.51 |
| Molecular Formula: | C22 H31 N3 O2 |
| Smiles: | C1CCC(CC1)CCC(N1[C@H]2CC[C@@H]1CC(C2)NC(c1ccncc1)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.2743 |
| logD: | 2.2738 |
| logSw: | -2.3456 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.798 |
| InChI Key: | GVZRQANZECYXGW-PMACEKPBSA-N |