N-{rel-(1R,5S)-8-[(3-chloro-4-methoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octan-3-yl}-4-fluorobenzamide
Chemical Structure Depiction of
N-{rel-(1R,5S)-8-[(3-chloro-4-methoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octan-3-yl}-4-fluorobenzamide
N-{rel-(1R,5S)-8-[(3-chloro-4-methoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octan-3-yl}-4-fluorobenzamide
Compound characteristics
| Compound ID: | T651-0525 |
| Compound Name: | N-{rel-(1R,5S)-8-[(3-chloro-4-methoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octan-3-yl}-4-fluorobenzamide |
| Molecular Weight: | 430.91 |
| Molecular Formula: | C23 H24 Cl F N2 O3 |
| Smiles: | COc1ccc(CC(N2[C@H]3CC[C@@H]2CC(C3)NC(c2ccc(cc2)F)=O)=O)cc1[Cl] |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.8593 |
| logD: | 2.8593 |
| logSw: | -3.6456 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.808 |
| InChI Key: | XDYIJIXAIXPQMK-YQQQUEKLSA-N |