3-methyl-1-{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}butan-1-one
Chemical Structure Depiction of
3-methyl-1-{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}butan-1-one
3-methyl-1-{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}butan-1-one
Compound characteristics
| Compound ID: | T655-0230 |
| Compound Name: | 3-methyl-1-{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}butan-1-one |
| Molecular Weight: | 383.49 |
| Molecular Formula: | C22 H29 N3 O3 |
| Smiles: | CC(C)CC(N1CC(c2nnc(c3ccc(C)cc3)o2)C2(CCOCC2)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4622 |
| logD: | 3.4622 |
| logSw: | -3.4558 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.937 |
| InChI Key: | ZEWJENHPBKRVEV-SFHVURJKSA-N |