{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}(1-phenylcyclopropyl)methanone
Chemical Structure Depiction of
{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}(1-phenylcyclopropyl)methanone
{4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}(1-phenylcyclopropyl)methanone
Compound characteristics
| Compound ID: | T655-0281 |
| Compound Name: | {4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}(1-phenylcyclopropyl)methanone |
| Molecular Weight: | 443.55 |
| Molecular Formula: | C27 H29 N3 O3 |
| Smiles: | Cc1ccc(cc1)c1nnc(C2CN(CC23CCOCC3)C(C2(CC2)c2ccccc2)=O)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9628 |
| logD: | 3.9628 |
| logSw: | -4.0336 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.444 |
| InChI Key: | LKCQCTJCEDALFI-QFIPXVFZSA-N |