(3-fluorophenyl){4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}methanone
Chemical Structure Depiction of
(3-fluorophenyl){4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}methanone
(3-fluorophenyl){4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}methanone
Compound characteristics
| Compound ID: | T655-0540 |
| Compound Name: | (3-fluorophenyl){4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-8-oxa-2-azaspiro[4.5]decan-2-yl}methanone |
| Molecular Weight: | 421.47 |
| Molecular Formula: | C24 H24 F N3 O3 |
| Smiles: | Cc1ccc(cc1)c1nnc(C2CN(CC23CCOCC3)C(c2cccc(c2)F)=O)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5084 |
| logD: | 3.5084 |
| logSw: | -3.6749 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.193 |
| InChI Key: | TYGZKJJJARIQOO-FQEVSTJZSA-N |