2-(cyclobutanecarbonyl)-N-(4-fluorophenyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide
Chemical Structure Depiction of
2-(cyclobutanecarbonyl)-N-(4-fluorophenyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide
2-(cyclobutanecarbonyl)-N-(4-fluorophenyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide
Compound characteristics
| Compound ID: | T787-3229 |
| Compound Name: | 2-(cyclobutanecarbonyl)-N-(4-fluorophenyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| Molecular Weight: | 360.43 |
| Molecular Formula: | C20 H25 F N2 O3 |
| Smiles: | C1CC(C1)C(N1CC(C(Nc2ccc(cc2)F)=O)C2(CCOCC2)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7708 |
| logD: | 1.7691 |
| logSw: | -2.4349 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.563 |
| InChI Key: | JGEGWXIEBHPRBT-QGZVFWFLSA-N |