cyclobutyl{2-[2-(morpholin-4-yl)ethyl]piperidin-1-yl}methanone
Chemical Structure Depiction of
cyclobutyl{2-[2-(morpholin-4-yl)ethyl]piperidin-1-yl}methanone
cyclobutyl{2-[2-(morpholin-4-yl)ethyl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | T802-0497 |
| Compound Name: | cyclobutyl{2-[2-(morpholin-4-yl)ethyl]piperidin-1-yl}methanone |
| Molecular Weight: | 280.41 |
| Molecular Formula: | C16 H28 N2 O2 |
| Smiles: | C1CCN(C(C1)CCN1CCOCC1)C(C1CCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3509 |
| logD: | 1.2531 |
| logSw: | -1.1727 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.6756 |
| InChI Key: | NZBMVABOOXRRQJ-OAHLLOKOSA-N |