3,3-dimethyl-1-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2-azaspiro[4.5]decan-2-yl]butan-1-one
Chemical Structure Depiction of
3,3-dimethyl-1-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2-azaspiro[4.5]decan-2-yl]butan-1-one
3,3-dimethyl-1-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2-azaspiro[4.5]decan-2-yl]butan-1-one
Compound characteristics
| Compound ID: | T808-2340 |
| Compound Name: | 3,3-dimethyl-1-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2-azaspiro[4.5]decan-2-yl]butan-1-one |
| Molecular Weight: | 383.49 |
| Molecular Formula: | C22 H29 N3 O3 |
| Smiles: | CC(C)(C)CC(N1CC(c2nc(c3ccccc3)no2)C2(CCOCC2)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3441 |
| logD: | 4.3441 |
| logSw: | -4.3526 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.099 |
| InChI Key: | FPAGSOOPOXKIDE-KRWDZBQOSA-N |