2-(3-chlorophenoxy)-1-{3-[(3-ethyl-3H-imidazo[4,5-b]pyridin-2-yl)methyl]pyrrolidin-1-yl}ethan-1-one
Chemical Structure Depiction of
2-(3-chlorophenoxy)-1-{3-[(3-ethyl-3H-imidazo[4,5-b]pyridin-2-yl)methyl]pyrrolidin-1-yl}ethan-1-one
2-(3-chlorophenoxy)-1-{3-[(3-ethyl-3H-imidazo[4,5-b]pyridin-2-yl)methyl]pyrrolidin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | T835-0633 |
| Compound Name: | 2-(3-chlorophenoxy)-1-{3-[(3-ethyl-3H-imidazo[4,5-b]pyridin-2-yl)methyl]pyrrolidin-1-yl}ethan-1-one |
| Molecular Weight: | 398.89 |
| Molecular Formula: | C21 H23 Cl N4 O2 |
| Smiles: | CCn1c(CC2CCN(C2)C(COc2cccc(c2)[Cl])=O)nc2cccnc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4858 |
| logD: | 3.4855 |
| logSw: | -3.5453 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.694 |
| InChI Key: | DXXSDCCBOZADKH-HNNXBMFYSA-N |