(2-chlorophenyl){3-[3-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-yl]pyrrolidin-1-yl}methanone
Chemical Structure Depiction of
(2-chlorophenyl){3-[3-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-yl]pyrrolidin-1-yl}methanone
(2-chlorophenyl){3-[3-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-yl]pyrrolidin-1-yl}methanone
Compound characteristics
| Compound ID: | T842-2271 |
| Compound Name: | (2-chlorophenyl){3-[3-(2-methoxyethyl)-3H-imidazo[4,5-c]pyridin-2-yl]pyrrolidin-1-yl}methanone |
| Molecular Weight: | 384.86 |
| Molecular Formula: | C20 H21 Cl N4 O2 |
| Smiles: | COCCn1c2cnccc2nc1C1CCN(C1)C(c1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6526 |
| logD: | 2.6521 |
| logSw: | -3.487 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.953 |
| InChI Key: | KKFWWTSLSIEZFX-CQSZACIVSA-N |