1-cyclopentyl-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxamide
Chemical Structure Depiction of
1-cyclopentyl-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxamide
1-cyclopentyl-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxamide
Compound characteristics
| Compound ID: | T855-0438 |
| Compound Name: | 1-cyclopentyl-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4,5,6-hexahydro-4aH-cyclopenta[b]pyridine-4a-carboxamide |
| Molecular Weight: | 352.48 |
| Molecular Formula: | C22 H28 N2 O2 |
| Smiles: | Cc1ccc(CNC(C23CCC=C3N(C3CCCC3)C(CC2)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4789 |
| logD: | 3.4789 |
| logSw: | -3.5582 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.997 |
| InChI Key: | RRRLLROWTWIRBC-JOCHJYFZSA-N |