1-(3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}piperidin-1-yl)-2-cyclopentylethan-1-one
Chemical Structure Depiction of
1-(3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}piperidin-1-yl)-2-cyclopentylethan-1-one
1-(3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}piperidin-1-yl)-2-cyclopentylethan-1-one
Compound characteristics
| Compound ID: | T955-0080 |
| Compound Name: | 1-(3-{3-[2-(benzyloxy)ethyl]-1,2,4-oxadiazol-5-yl}piperidin-1-yl)-2-cyclopentylethan-1-one |
| Molecular Weight: | 397.52 |
| Molecular Formula: | C23 H31 N3 O3 |
| Smiles: | C1CCC(C1)CC(N1CCCC(C1)c1nc(CCOCc2ccccc2)no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9087 |
| logD: | 3.9087 |
| logSw: | -4.0502 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.6 |
| InChI Key: | SHQDPQLZBVOZPT-FQEVSTJZSA-N |